C29H43FN2O — CID 139778675
3-[4-[2-(4-butylcyclohexyl)ethyl]-3-fluorophenyl]-6-heptoxypyridazine (PubChem CID 139778675) has the molecular formula C29H43FN2O and a molecular weight of 454.67 g/mol. Its IUPAC name is 3-[4-[2-(4-butylcyclohexyl)ethyl]-3-fluorophenyl]-6-heptoxypyridazine.
| Compound Name | 3-[4-[2-(4-butylcyclohexyl)ethyl]-3-fluorophenyl]-6-heptoxypyridazine |
|---|---|
| PubChem CID | 139778675 |
| Molecular Formula | C29H43FN2O |
| Molecular Weight | 454.67 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 3-[4-[2-(4-butylcyclohexyl)ethyl]-3-fluorophenyl]-6-heptoxypyridazine |
| SMILES | CCCCCCCOc1ccc(-c2ccc(CCC3CCC(CCCC)CC3)c(F)c2)nn1 |
| InChI | InChI=1S/C29H43FN2O/c1-3-5-7-8-9-21-33-29-20-19-28(31-32-29)26-18-17-25(27(30)22-26)16-15-24-13-11-23(12-14-24)10-6-4-2/h17-20,22-24H,3-16,21H2,1-2H3 |
| InChIKey | FSKYLGNGUHYPEF-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.67 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|