C25H35FN2O — CID 139779031
3-[3-fluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl]-6-hexoxypyridazine (PubChem CID 139779031) has the molecular formula C25H35FN2O and a molecular weight of 398.57 g/mol. Its IUPAC name is 3-[3-fluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl]-6-hexoxypyridazine.
| Compound Name | 3-[3-fluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl]-6-hexoxypyridazine |
|---|---|
| PubChem CID | 139779031 |
| Molecular Formula | C25H35FN2O |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 3-[3-fluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl]-6-hexoxypyridazine |
| SMILES | CCCCCCOc1ccc(-c2ccc(CCC3CCC(C)CC3)c(F)c2)nn1 |
| InChI | InChI=1S/C25H35FN2O/c1-3-4-5-6-17-29-25-16-15-24(27-28-25)22-14-13-21(23(26)18-22)12-11-20-9-7-19(2)8-10-20/h13-16,18-20H,3-12,17H2,1-2H3 |
| InChIKey | WSXXSPLWMFLPJD-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|