C31H45F3OSi — CID 173311068
4-[4-(3,5-difluoro-4-nonan-2-yloxyphenyl)phenyl]-1-(4-fluoropentyl)silinane (PubChem CID 173311068) has the molecular formula C31H45F3OSi and a molecular weight of 518.78 g/mol. Its IUPAC name is 4-[4-(3,5-difluoro-4-nonan-2-yloxyphenyl)phenyl]-1-(4-fluoropentyl)silinane.
| Compound Name | 4-[4-(3,5-difluoro-4-nonan-2-yloxyphenyl)phenyl]-1-(4-fluoropentyl)silinane |
|---|---|
| PubChem CID | 173311068 |
| Molecular Formula | C31H45F3OSi |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | 4-[4-(3,5-difluoro-4-nonan-2-yloxyphenyl)phenyl]-1-(4-fluoropentyl)silinane |
| SMILES | CCCCCCCC(C)Oc1c(F)cc(-c2ccc(C3CC[SiH](CCCC(C)F)CC3)cc2)cc1F |
| InChI | InChI=1S/C31H45F3OSi/c1-4-5-6-7-8-11-24(3)35-31-29(33)21-28(22-30(31)34)26-14-12-25(13-15-26)27-16-19-36(20-17-27)18-9-10-23(2)32/h12-15,21-24,27,36H,4-11,16-20H2,1-3H3 |
| InChIKey | SRJZGBOXXFNFOP-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|