C32H44F2O — CID 20750952
1,3-difluoro-5-[4-[4-[(E)-3-methylpent-1-enyl]cyclohexyl]phenyl]-2-octan-2-yloxybenzene (PubChem CID 20750952) has the molecular formula C32H44F2O and a molecular weight of 482.70 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-[4-[(E)-3-methylpent-1-enyl]cyclohexyl]phenyl]-2-octan-2-yloxybenzene.
| Compound Name | 1,3-difluoro-5-[4-[4-[(E)-3-methylpent-1-enyl]cyclohexyl]phenyl]-2-octan-2-yloxybenzene |
|---|---|
| PubChem CID | 20750952 |
| Molecular Formula | C32H44F2O |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 1,3-difluoro-5-[4-[4-[(E)-3-methylpent-1-enyl]cyclohexyl]phenyl]-2-octan-2-yloxybenzene |
| SMILES | CCCCCCC(C)Oc1c(F)cc(-c2ccc(C3CCC(/C=C/C(C)CC)CC3)cc2)cc1F |
| InChI | InChI=1S/C32H44F2O/c1-5-7-8-9-10-24(4)35-32-30(33)21-29(22-31(32)34)28-19-17-27(18-20-28)26-15-13-25(14-16-26)12-11-23(3)6-2/h11-12,17-26H,5-10,13-16H2,1-4H3/b12-11+ |
| InChIKey | XFZREHYUMPGGPT-VAWYXSNFSA-N |
| XLogP | 10.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|