C31H45F2NO — CID 144733803
2,6-difluoro-4-[4-[4-[(E)-3-methylpent-1-enyl]cyclohexyl]phenyl]phenol;N-methylhexan-1-amine (PubChem CID 144733803) has the molecular formula C31H45F2NO and a molecular weight of 485.70 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-[4-[(E)-3-methylpent-1-enyl]cyclohexyl]phenyl]phenol;N-methylhexan-1-amine.
| Compound Name | 2,6-difluoro-4-[4-[4-[(E)-3-methylpent-1-enyl]cyclohexyl]phenyl]phenol;N-methylhexan-1-amine |
|---|---|
| PubChem CID | 144733803 |
| Molecular Formula | C31H45F2NO |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.35 |
| IUPAC Name | 2,6-difluoro-4-[4-[4-[(E)-3-methylpent-1-enyl]cyclohexyl]phenyl]phenol;N-methylhexan-1-amine |
| SMILES | CCC(C)/C=C/C1CCC(c2ccc(-c3cc(F)c(O)c(F)c3)cc2)CC1.CCCCCCNC |
| InChI | InChI=1S/C24H28F2O.C7H17N/c1-3-16(2)4-5-17-6-8-18(9-7-17)19-10-12-20(13-11-19)21-14-22(25)24(27)23(26)15-21;1-3-4-5-6-7-8-2/h4-5,10-18,27H,3,6-9H2,1-2H3;8H,3-7H2,1-2H3/b5-4+; |
| InChIKey | HWVJBZWHZRDOJY-FXRZFVDSSA-N |
| XLogP | 9.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|