C33H44FNO — CID 20654489
5-[2-fluoro-4-[4-[(E)-2-(4-prop-2-enoxycyclohexyl)ethenyl]cyclohexyl]phenyl]-2-pentylpyridine (PubChem CID 20654489) has the molecular formula C33H44FNO and a molecular weight of 489.72 g/mol. Its IUPAC name is 5-[2-fluoro-4-[4-[(E)-2-(4-prop-2-enoxycyclohexyl)ethenyl]cyclohexyl]phenyl]-2-pentylpyridine.
| Compound Name | 5-[2-fluoro-4-[4-[(E)-2-(4-prop-2-enoxycyclohexyl)ethenyl]cyclohexyl]phenyl]-2-pentylpyridine |
|---|---|
| PubChem CID | 20654489 |
| Molecular Formula | C33H44FNO |
| Molecular Weight | 489.72 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | 5-[2-fluoro-4-[4-[(E)-2-(4-prop-2-enoxycyclohexyl)ethenyl]cyclohexyl]phenyl]-2-pentylpyridine |
| SMILES | C=CCOC1CCC(/C=C/C2CCC(c3ccc(-c4ccc(CCCCC)nc4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C33H44FNO/c1-3-5-6-7-30-18-16-29(24-35-30)32-21-17-28(23-33(32)34)27-14-10-25(11-15-27)8-9-26-12-19-31(20-13-26)36-22-4-2/h4,8-9,16-18,21,23-27,31H,2-3,5-7,10-15,19-20,22H2,1H3/b9-8+ |
| InChIKey | IWEZCMSPJHPFCW-CMDGGOBGSA-N |
| XLogP | 9.21 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.72 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|