C36H39F3O — CID 77345350
2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-prop-2-enoxybenzene (PubChem CID 77345350) has the molecular formula C36H39F3O and a molecular weight of 544.70 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-prop-2-enoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 77345350 |
| Molecular Formula | C36H39F3O |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(C4CCC(C5CCC(C=CC)CC5)CC4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C36H39F3O/c1-3-5-24-6-8-25(9-7-24)26-10-12-27(13-11-26)30-18-19-31(33(37)23-30)28-14-16-29(17-15-28)32-20-21-34(40-22-4-2)36(39)35(32)38/h3-5,14-21,23-27H,2,6-13,22H2,1H3 |
| InChIKey | LRWHOCZXSAZTEG-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|