C38H45F3O — CID 77345346
2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-pentoxybenzene (PubChem CID 77345346) has the molecular formula C38H45F3O and a molecular weight of 574.77 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-pentoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-pentoxybenzene |
|---|---|
| PubChem CID | 77345346 |
| Molecular Formula | C38H45F3O |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-pentoxybenzene |
| SMILES | CC=CC1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(OCCCCC)c(F)c5F)cc4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C38H45F3O/c1-3-5-6-24-42-36-23-22-34(37(40)38(36)41)31-18-16-30(17-19-31)33-21-20-32(25-35(33)39)29-14-12-28(13-15-29)27-10-8-26(7-4-2)9-11-27/h4,7,16-23,25-29H,3,5-6,8-15,24H2,1-2H3 |
| InChIKey | NEXCBHITJDZECB-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|