C26H33NO — CID 21318420
4-[4-(4-heptan-2-yloxyphenyl)cyclohexyl]benzonitrile (PubChem CID 21318420) has the molecular formula C26H33NO and a molecular weight of 375.56 g/mol. Its IUPAC name is 4-[4-(4-heptan-2-yloxyphenyl)cyclohexyl]benzonitrile.
| Compound Name | 4-[4-(4-heptan-2-yloxyphenyl)cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 21318420 |
| Molecular Formula | C26H33NO |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 4-[4-(4-heptan-2-yloxyphenyl)cyclohexyl]benzonitrile |
| SMILES | CCCCCC(C)Oc1ccc(C2CCC(c3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H33NO/c1-3-4-5-6-20(2)28-26-17-15-25(16-18-26)24-13-11-23(12-14-24)22-9-7-21(19-27)8-10-22/h7-10,15-18,20,23-24H,3-6,11-14H2,1-2H3 |
| InChIKey | QUWBHPSTZBOWJD-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|