C27H35NO — CID 21318431
4-[4-[4-(2-ethylhexoxy)phenyl]cyclohexyl]benzonitrile (PubChem CID 21318431) has the molecular formula C27H35NO and a molecular weight of 389.58 g/mol. Its IUPAC name is 4-[4-[4-(2-ethylhexoxy)phenyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[4-(2-ethylhexoxy)phenyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 21318431 |
| Molecular Formula | C27H35NO |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 4-[4-[4-(2-ethylhexoxy)phenyl]cyclohexyl]benzonitrile |
| SMILES | CCCCC(CC)COc1ccc(C2CCC(c3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H35NO/c1-3-5-6-21(4-2)20-29-27-17-15-26(16-18-27)25-13-11-24(12-14-25)23-9-7-22(19-28)8-10-23/h7-10,15-18,21,24-25H,3-6,11-14,20H2,1-2H3 |
| InChIKey | BOTVNQVARGNMNZ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |