C67H77N3O7 — CID 172539122
4-[[3,7-bis[4-(4-butylcyclohexyl)phenoxy]-5-[4-(2-ethylhexoxy)anilino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]benzonitrile (PubChem CID 172539122) has the molecular formula C67H77N3O7 and a molecular weight of 1036.37 g/mol. Its IUPAC name is 4-[[3,7-bis[4-(4-butylcyclohexyl)phenoxy]-5-[4-(2-ethylhexoxy)anilino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]benzonitrile.
| Compound Name | 4-[[3,7-bis[4-(4-butylcyclohexyl)phenoxy]-5-[4-(2-ethylhexoxy)anilino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 172539122 |
| Molecular Formula | C67H77N3O7 |
| Molecular Weight | 1036.37 g/mol |
| Exact Mass | 1035.58 |
| IUPAC Name | 4-[[3,7-bis[4-(4-butylcyclohexyl)phenoxy]-5-[4-(2-ethylhexoxy)anilino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]benzonitrile |
| SMILES | CCCCC1CCC(c2ccc(Oc3cc(Nc4ccc(C#N)cc4)c4c(c3O)C(=O)c3c(Nc5ccc(OCC(CC)CCCC)cc5)cc(Oc5ccc(C6CCC(CCCC)CC6)cc5)c(O)c3C4=O)cc2)CC1 |
| InChI | InChI=1S/C67H77N3O7/c1-5-9-12-43(8-4)42-75-53-37-31-52(32-38-53)70-57-40-59(77-55-35-27-50(28-36-55)48-23-17-45(18-24-48)14-11-7-3)65(72)63-61(57)67(74)62-60(66(63)73)56(69-51-29-19-46(41-68)20-30-51)39-58(64(62)71)76-54-33-25-49(26-34-54)47-21-15-44(16-22-47)13-10-6-2/h19-20,25-40,43-45,47-48,69-72H,5-18,21-24,42H2,1-4H3 |
| InChIKey | VZIMMQHBHZGQBX-UHFFFAOYSA-N |
| XLogP | 18.34 |
| TPSA | 150.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.37 |
| LogP ≤ 5 | 18.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|