C58H70N2O6 — CID 170778624
4-amino-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-8-(4-hexylanilino)-1,5-dihydroxyanthracene-9,10-dione (PubChem CID 170778624) has the molecular formula C58H70N2O6 and a molecular weight of 891.21 g/mol. Its IUPAC name is 4-amino-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-8-(4-hexylanilino)-1,5-dihydroxyanthracene-9,10-dione.
| Compound Name | 4-amino-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-8-(4-hexylanilino)-1,5-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 170778624 |
| Molecular Formula | C58H70N2O6 |
| Molecular Weight | 891.21 g/mol |
| Exact Mass | 890.52 |
| IUPAC Name | 4-amino-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-8-(4-hexylanilino)-1,5-dihydroxyanthracene-9,10-dione |
| SMILES | CCCCCCc1ccc(Nc2cc(Oc3ccc(C4CCC(CCCC)CC4)cc3)c(O)c3c2C(=O)c2c(O)c(Oc4ccc(C5CCC(CCCC)CC5)cc4)cc(N)c2C3=O)cc1 |
| InChI | InChI=1S/C58H70N2O6/c1-4-7-10-11-14-39-19-29-44(30-20-39)60-48-36-50(66-46-33-27-43(28-34-46)41-23-17-38(18-24-41)13-9-6-3)56(62)54-52(48)58(64)53-51(57(54)63)47(59)35-49(55(53)61)65-45-31-25-42(26-32-45)40-21-15-37(16-22-40)12-8-5-2/h19-20,25-38,40-41,60-62H,4-18,21-24,59H2,1-3H3 |
| InChIKey | HDNCDBJHTSFHJN-UHFFFAOYSA-N |
| XLogP | 15.83 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.21 |
| LogP ≤ 5 | 15.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|