C59H63N3O8 — CID 172547675
methyl 2-[[5-(2-cyanoanilino)-4,8-dihydroxy-3,7-bis(4-nonylphenoxy)-9,10-dioxoanthracen-1-yl]amino]benzoate (PubChem CID 172547675) has the molecular formula C59H63N3O8 and a molecular weight of 942.17 g/mol. Its IUPAC name is methyl 2-[[5-(2-cyanoanilino)-4,8-dihydroxy-3,7-bis(4-nonylphenoxy)-9,10-dioxoanthracen-1-yl]amino]benzoate.
| Compound Name | methyl 2-[[5-(2-cyanoanilino)-4,8-dihydroxy-3,7-bis(4-nonylphenoxy)-9,10-dioxoanthracen-1-yl]amino]benzoate |
|---|---|
| PubChem CID | 172547675 |
| Molecular Formula | C59H63N3O8 |
| Molecular Weight | 942.17 g/mol |
| Exact Mass | 941.46 |
| IUPAC Name | methyl 2-[[5-(2-cyanoanilino)-4,8-dihydroxy-3,7-bis(4-nonylphenoxy)-9,10-dioxoanthracen-1-yl]amino]benzoate |
| SMILES | CCCCCCCCCc1ccc(Oc2cc(Nc3ccccc3C#N)c3c(c2O)C(=O)c2c(Nc4ccccc4C(=O)OC)cc(Oc4ccc(CCCCCCCCC)cc4)c(O)c2C3=O)cc1 |
| InChI | InChI=1S/C59H63N3O8/c1-4-6-8-10-12-14-16-22-39-28-32-42(33-29-39)69-49-36-47(61-45-26-20-18-24-41(45)38-60)51-53(55(49)63)58(66)52-48(62-46-27-21-19-25-44(46)59(67)68-3)37-50(56(64)54(52)57(51)65)70-43-34-30-40(31-35-43)23-17-15-13-11-9-7-5-2/h18-21,24-37,61-64H,4-17,22-23H2,1-3H3 |
| InChIKey | DTDJZRRWEBMYPU-UHFFFAOYSA-N |
| XLogP | 15.19 |
| TPSA | 167.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.17 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|