C63H69F3N2O6 — CID 172539135
4-(4-butylanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-[3-(trifluoromethyl)anilino]anthracene-9,10-dione (PubChem CID 172539135) has the molecular formula C63H69F3N2O6 and a molecular weight of 1007.25 g/mol. Its IUPAC name is 4-(4-butylanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-[3-(trifluoromethyl)anilino]anthracene-9,10-dione.
| Compound Name | 4-(4-butylanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-[3-(trifluoromethyl)anilino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 172539135 |
| Molecular Formula | C63H69F3N2O6 |
| Molecular Weight | 1007.25 g/mol |
| Exact Mass | 1006.51 |
| IUPAC Name | 4-(4-butylanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-[3-(trifluoromethyl)anilino]anthracene-9,10-dione |
| SMILES | CCCCc1ccc(Nc2cc(Oc3ccc(C4CCC(CCCC)CC4)cc3)c(O)c3c2C(=O)c2c(O)c(Oc4ccc(C5CCC(CCCC)CC5)cc4)cc(Nc4cccc(C(F)(F)F)c4)c2C3=O)cc1 |
| InChI | InChI=1S/C63H69F3N2O6/c1-4-7-11-39-16-22-42(23-17-39)44-26-32-49(33-27-44)73-53-37-51(67-47-30-20-41(21-31-47)13-9-6-3)55-57(59(53)69)62(72)56-52(68-48-15-10-14-46(36-48)63(64,65)66)38-54(60(70)58(56)61(55)71)74-50-34-28-45(29-35-50)43-24-18-40(19-25-43)12-8-5-2/h10,14-15,20-21,26-40,42-43,67-70H,4-9,11-13,16-19,22-25H2,1-3H3 |
| InChIKey | ZVGXKSACWHJYFH-UHFFFAOYSA-N |
| XLogP | 18.23 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.25 |
| LogP ≤ 5 | 18.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|