C46H48N2O3S — CID 59222153
1-amino-5-anilino-8-[4-[4-(4-pentylcyclohexyl)phenyl]phenoxy]-4-propylsulfanylanthracene-9,10-dione (PubChem CID 59222153) has the molecular formula C46H48N2O3S and a molecular weight of 708.97 g/mol. Its IUPAC name is 1-amino-5-anilino-8-[4-[4-(4-pentylcyclohexyl)phenyl]phenoxy]-4-propylsulfanylanthracene-9,10-dione.
| Compound Name | 1-amino-5-anilino-8-[4-[4-(4-pentylcyclohexyl)phenyl]phenoxy]-4-propylsulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 59222153 |
| Molecular Formula | C46H48N2O3S |
| Molecular Weight | 708.97 g/mol |
| Exact Mass | 708.34 |
| IUPAC Name | 1-amino-5-anilino-8-[4-[4-(4-pentylcyclohexyl)phenyl]phenoxy]-4-propylsulfanylanthracene-9,10-dione |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(Oc4ccc(Nc5ccccc5)c5c4C(=O)c4c(N)ccc(SCCC)c4C5=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C46H48N2O3S/c1-3-5-7-10-30-13-15-31(16-14-30)32-17-19-33(20-18-32)34-21-23-36(24-22-34)51-39-27-26-38(48-35-11-8-6-9-12-35)42-43(39)45(49)41-37(47)25-28-40(52-29-4-2)44(41)46(42)50/h6,8-9,11-12,17-28,30-31,48H,3-5,7,10,13-16,29,47H2,1-2H3 |
| InChIKey | YKGLZFNRQBDRDQ-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.97 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|