C63H69N3O7 — CID 172539125
4-(4-butoxyanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-(4-isocyanoanilino)anthracene-9,10-dione (PubChem CID 172539125) has the molecular formula C63H69N3O7 and a molecular weight of 980.26 g/mol. Its IUPAC name is 4-(4-butoxyanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-(4-isocyanoanilino)anthracene-9,10-dione.
| Compound Name | 4-(4-butoxyanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-(4-isocyanoanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 172539125 |
| Molecular Formula | C63H69N3O7 |
| Molecular Weight | 980.26 g/mol |
| Exact Mass | 979.51 |
| IUPAC Name | 4-(4-butoxyanilino)-2,6-bis[4-(4-butylcyclohexyl)phenoxy]-1,5-dihydroxy-8-(4-isocyanoanilino)anthracene-9,10-dione |
| SMILES | [C-]#[N+]c1ccc(Nc2cc(Oc3ccc(C4CCC(CCCC)CC4)cc3)c(O)c3c2C(=O)c2c(O)c(Oc4ccc(C5CCC(CCCC)CC5)cc4)cc(Nc4ccc(OCCCC)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C63H69N3O7/c1-5-8-11-40-13-17-42(18-14-40)44-21-31-50(32-22-44)72-54-38-52(65-47-27-25-46(64-4)26-28-47)56-58(60(54)67)63(70)57-53(66-48-29-35-49(36-30-48)71-37-10-7-3)39-55(61(68)59(57)62(56)69)73-51-33-23-45(24-34-51)43-19-15-41(16-20-43)12-9-6-2/h21-36,38-43,65-68H,5-20,37H2,1-3H3 |
| InChIKey | LGBNDSCJZWOPPQ-UHFFFAOYSA-N |
| XLogP | 17.60 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.26 |
| LogP ≤ 5 | 17.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|