C73H82N2O8 — CID 176786543
[4-[[5-(4-butylanilino)-3,7-bis[4-(4-butylcyclohexyl)phenoxy]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]phenyl] 4-butylbenzoate (PubChem CID 176786543) has the molecular formula C73H82N2O8 and a molecular weight of 1115.46 g/mol. Its IUPAC name is [4-[[5-(4-butylanilino)-3,7-bis[4-(4-butylcyclohexyl)phenoxy]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]phenyl] 4-butylbenzoate.
| Compound Name | [4-[[5-(4-butylanilino)-3,7-bis[4-(4-butylcyclohexyl)phenoxy]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]phenyl] 4-butylbenzoate |
|---|---|
| PubChem CID | 176786543 |
| Molecular Formula | C73H82N2O8 |
| Molecular Weight | 1115.46 g/mol |
| Exact Mass | 1114.61 |
| IUPAC Name | [4-[[5-(4-butylanilino)-3,7-bis[4-(4-butylcyclohexyl)phenoxy]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]phenyl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(Nc2cc(Oc3ccc(C4CCC(CCCC)CC4)cc3)c(O)c3c2C(=O)c2c(O)c(Oc4ccc(C5CCC(CCCC)CC5)cc4)cc(Nc4ccc(OC(=O)c5ccc(CCCC)cc5)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C73H82N2O8/c1-5-9-13-47-17-25-51(26-18-47)53-31-39-58(40-32-53)81-63-45-61(74-56-35-23-50(24-36-56)16-12-8-4)65-67(69(63)76)72(79)66-62(75-57-37-43-60(44-38-57)83-73(80)55-29-21-49(22-30-55)15-11-7-3)46-64(70(77)68(66)71(65)78)82-59-41-33-54(34-42-59)52-27-19-48(20-28-52)14-10-6-2/h21-24,29-48,51-52,74-77H,5-20,25-28H2,1-4H3 |
| InChIKey | HAUYGKWWAKUBQW-UHFFFAOYSA-N |
| XLogP | 19.78 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.46 |
| LogP ≤ 5 | 19.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|