C58H65ClN2O6 — CID 172547669
4-anilino-8-(4-chloroanilino)-2,6-bis(4-decylphenoxy)-1,5-dihydroxyanthracene-9,10-dione (PubChem CID 172547669) has the molecular formula C58H65ClN2O6 and a molecular weight of 921.62 g/mol. Its IUPAC name is 4-anilino-8-(4-chloroanilino)-2,6-bis(4-decylphenoxy)-1,5-dihydroxyanthracene-9,10-dione.
| Compound Name | 4-anilino-8-(4-chloroanilino)-2,6-bis(4-decylphenoxy)-1,5-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 172547669 |
| Molecular Formula | C58H65ClN2O6 |
| Molecular Weight | 921.62 g/mol |
| Exact Mass | 920.45 |
| IUPAC Name | 4-anilino-8-(4-chloroanilino)-2,6-bis(4-decylphenoxy)-1,5-dihydroxyanthracene-9,10-dione |
| SMILES | CCCCCCCCCCc1ccc(Oc2cc(Nc3ccccc3)c3c(c2O)C(=O)c2c(Nc4ccc(Cl)cc4)cc(Oc4ccc(CCCCCCCCCC)cc4)c(O)c2C3=O)cc1 |
| InChI | InChI=1S/C58H65ClN2O6/c1-3-5-7-9-11-13-15-18-22-40-26-34-45(35-27-40)66-49-38-47(60-43-24-20-17-21-25-43)51-53(55(49)62)58(65)52-48(61-44-32-30-42(59)31-33-44)39-50(56(63)54(52)57(51)64)67-46-36-28-41(29-37-46)23-19-16-14-12-10-8-6-4-2/h17,20-21,24-39,60-63H,3-16,18-19,22-23H2,1-2H3 |
| InChIKey | YTYHGKRWVMLVGD-UHFFFAOYSA-N |
| XLogP | 16.96 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.62 |
| LogP ≤ 5 | 16.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|