C40H31N2NaO7S — CID 59979959
sodium 4-[[16-benzoyl-8,15-dioxo-12-(4-pentylphenoxy)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaen-10-yl]amino]benzenesulfonate (PubChem CID 59979959) has the molecular formula C40H31N2NaO7S and a molecular weight of 706.75 g/mol. Its IUPAC name is sodium 4-[[16-benzoyl-8,15-dioxo-12-(4-pentylphenoxy)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaen-10-yl]amino]benzenesulfonate.
| Compound Name | sodium 4-[[16-benzoyl-8,15-dioxo-12-(4-pentylphenoxy)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaen-10-yl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 59979959 |
| Molecular Formula | C40H31N2NaO7S |
| Molecular Weight | 706.75 g/mol |
| Exact Mass | 706.17 |
| IUPAC Name | sodium 4-[[16-benzoyl-8,15-dioxo-12-(4-pentylphenoxy)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaen-10-yl]amino]benzenesulfonate |
| SMILES | CCCCCc1ccc(Oc2cc(Nc3ccc(S(=O)(=O)[O-])cc3)c3c4c(c(C(=O)c5ccccc5)c(=O)[nH]c24)-c2ccccc2C3=O)cc1.[Na+] |
| InChI | InChI=1S/C40H32N2O7S.Na/c1-2-3-5-10-24-15-19-27(20-16-24)49-32-23-31(41-26-17-21-28(22-18-26)50(46,47)48)34-35-33(29-13-8-9-14-30(29)39(34)44)36(40(45)42-37(32)35)38(43)25-11-6-4-7-12-25;/h4,6-9,11-23,41H,2-3,5,10H2,1H3,(H,42,45)(H,46,47,48);/q;+1/p-1 |
| InChIKey | IWNVMPKZUIOGTH-UHFFFAOYSA-M |
| XLogP | 5.15 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.75 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|