C37H38N2O4 — CID 90068744
(4-butylphenyl) 1-amino-4-(4-hexylanilino)-9,10-dioxoanthracene-2-carboxylate (PubChem CID 90068744) has the molecular formula C37H38N2O4 and a molecular weight of 574.72 g/mol. Its IUPAC name is (4-butylphenyl) 1-amino-4-(4-hexylanilino)-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (4-butylphenyl) 1-amino-4-(4-hexylanilino)-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 90068744 |
| Molecular Formula | C37H38N2O4 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | (4-butylphenyl) 1-amino-4-(4-hexylanilino)-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCCCCCc1ccc(Nc2cc(C(=O)Oc3ccc(CCCC)cc3)c(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C37H38N2O4/c1-3-5-7-8-12-25-15-19-26(20-16-25)39-31-23-30(37(42)43-27-21-17-24(18-22-27)11-6-4-2)34(38)33-32(31)35(40)28-13-9-10-14-29(28)36(33)41/h9-10,13-23,39H,3-8,11-12,38H2,1-2H3 |
| InChIKey | RBIOSDDGXKFPRU-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|