C39H48N2O4 — CID 14149643
(4-butylcyclohexyl) 1-amino-4-(4-octylanilino)-9,10-dioxoanthracene-2-carboxylate (PubChem CID 14149643) has the molecular formula C39H48N2O4 and a molecular weight of 608.82 g/mol. Its IUPAC name is (4-butylcyclohexyl) 1-amino-4-(4-octylanilino)-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (4-butylcyclohexyl) 1-amino-4-(4-octylanilino)-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 14149643 |
| Molecular Formula | C39H48N2O4 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | (4-butylcyclohexyl) 1-amino-4-(4-octylanilino)-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCCCCCCCc1ccc(Nc2cc(C(=O)OC3CCC(CCCC)CC3)c(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C39H48N2O4/c1-3-5-7-8-9-10-14-27-17-21-28(22-18-27)41-33-25-32(39(44)45-29-23-19-26(20-24-29)13-6-4-2)36(40)35-34(33)37(42)30-15-11-12-16-31(30)38(35)43/h11-12,15-18,21-22,25-26,29,41H,3-10,13-14,19-20,23-24,40H2,1-2H3 |
| InChIKey | OAQLYWXGEGEYSN-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|