C29H33NO4S — CID 14548727
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl 1-amino-4-butylsulfanyl-9,10-dioxoanthracene-2-carboxylate (PubChem CID 14548727) has the molecular formula C29H33NO4S and a molecular weight of 491.65 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl 1-amino-4-butylsulfanyl-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl 1-amino-4-butylsulfanyl-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 14548727 |
| Molecular Formula | C29H33NO4S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl 1-amino-4-butylsulfanyl-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCCCSc1cc(C(=O)OC2CCC3CCCCC3C2)c(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H33NO4S/c1-2-3-14-35-23-16-22(29(33)34-19-13-12-17-8-4-5-9-18(17)15-19)26(30)25-24(23)27(31)20-10-6-7-11-21(20)28(25)32/h6-7,10-11,16-19H,2-5,8-9,12-15,30H2,1H3 |
| InChIKey | QRFASVOXKAZYCJ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|