C25H23ClO4 — CID 70396570
[(2R,4aR)-6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 70396570) has the molecular formula C25H23ClO4 and a molecular weight of 422.91 g/mol. Its IUPAC name is [(2R,4aR)-6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [(2R,4aR)-6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 70396570 |
| Molecular Formula | C25H23ClO4 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [(2R,4aR)-6-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | O=C(O[C@@H]1CC[C@@H]2CC(Cl)CCC2C1)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H23ClO4/c26-16-10-8-15-13-17(11-9-14(15)12-16)30-25(29)21-7-3-6-20-22(21)24(28)19-5-2-1-4-18(19)23(20)27/h1-7,14-17H,8-13H2/t14-,15?,16?,17-/m1/s1 |
| InChIKey | RSYJCXRIYXCVDG-RDHHWEPZSA-N |
| XLogP | 5.20 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|