C19H15NO4 — CID 123444517
cyclopropyl 2-[(1,3-dioxoisoindol-2-yl)methyl]benzoate (PubChem CID 123444517) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is cyclopropyl 2-[(1,3-dioxoisoindol-2-yl)methyl]benzoate.
| Compound Name | cyclopropyl 2-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 123444517 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | cyclopropyl 2-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
| SMILES | O=C(OC1CC1)c1ccccc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H15NO4/c21-17-15-7-3-4-8-16(15)18(22)20(17)11-12-5-1-2-6-14(12)19(23)24-13-9-10-13/h1-8,13H,9-11H2 |
| InChIKey | PNVNFGSKRYZLOT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|