(1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate

C23H17NO5 — CID 16520775

IUPAC(1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate
SMILESO=C(OCN1C(=O)c2ccccc2C1=O)c1ccccc1COc1ccccc1
InChIInChI=1S/C23H17NO5/c25-21-19-12-6-7-13-20(19)22(26)24(21)15-29-23(27)18-11-5-4-8-16(18)14-28-17-9-2-1-3-10-17/h1-13H,14-15H2
InChIKeyGCAGKZBSFBVXEA-UHFFFAOYSA-N
MW387.39 g/mol
LogP3.68
Rot. Bonds6

About (1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate

(1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate (PubChem CID 16520775) has the molecular formula C23H17NO5 and a molecular weight of 387.39 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate.

Molecular Properties

Compound Name(1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate
PubChem CID16520775
Molecular FormulaC23H17NO5
Molecular Weight387.39 g/mol
Exact Mass387.11
IUPAC Name(1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate
SMILESO=C(OCN1C(=O)c2ccccc2C1=O)c1ccccc1COc1ccccc1
InChIInChI=1S/C23H17NO5/c25-21-19-12-6-7-13-20(19)22(26)24(21)15-29-23(27)18-11-5-4-8-16(18)14-28-17-9-2-1-3-10-17/h1-13H,14-15H2
InChIKeyGCAGKZBSFBVXEA-UHFFFAOYSA-N
XLogP3.68
TPSA72.91 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500387.39
LogP ≤ 53.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate?
The IUPAC name of (1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate (CID 16520775) is (1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate.
What is the SMILES notation for (1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate?
The canonical SMILES for (1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate is O=C(OCN1C(=O)c2ccccc2C1=O)c1ccccc1COc1ccccc1.
What is the InChIKey of (1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate?
The InChIKey is GCAGKZBSFBVXEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO5/c25-21-19-12-6-7-13-20(19)22(26)24(21)15-29-23(27)18-11-5-4-8-16(18)14-28-17-9-2-1-3-10-17/h1-13H,14-15H2.
What are the key properties of (1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate?
(1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate has a molecular weight of 387.39 g/mol, XLogP of 3.68, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxoisoindol-2-yl)methyl 2-(phenoxymethyl)benzoate is sourced from PubChem (CID 16520775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).