C19H14FNO4 — CID 174738917
cyclobutyl 3-(1,3-dioxoisoindol-2-yl)-4-fluorobenzoate (PubChem CID 174738917) has the molecular formula C19H14FNO4 and a molecular weight of 339.32 g/mol. Its IUPAC name is cyclobutyl 3-(1,3-dioxoisoindol-2-yl)-4-fluorobenzoate.
| Compound Name | cyclobutyl 3-(1,3-dioxoisoindol-2-yl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 174738917 |
| Molecular Formula | C19H14FNO4 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | cyclobutyl 3-(1,3-dioxoisoindol-2-yl)-4-fluorobenzoate |
| SMILES | O=C(OC1CCC1)c1ccc(F)c(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C19H14FNO4/c20-15-9-8-11(19(24)25-12-4-3-5-12)10-16(15)21-17(22)13-6-1-2-7-14(13)18(21)23/h1-2,6-10,12H,3-5H2 |
| InChIKey | MKXOAAPCEJINOW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|