C17H12FNO4 — CID 168519228
methyl 3-(1,3-dioxoisoindol-2-yl)-5-fluoro-4-methylbenzoate (PubChem CID 168519228) has the molecular formula C17H12FNO4 and a molecular weight of 313.28 g/mol. Its IUPAC name is methyl 3-(1,3-dioxoisoindol-2-yl)-5-fluoro-4-methylbenzoate.
| Compound Name | methyl 3-(1,3-dioxoisoindol-2-yl)-5-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 168519228 |
| Molecular Formula | C17H12FNO4 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | methyl 3-(1,3-dioxoisoindol-2-yl)-5-fluoro-4-methylbenzoate |
| SMILES | COC(=O)c1cc(F)c(C)c(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C17H12FNO4/c1-9-13(18)7-10(17(22)23-2)8-14(9)19-15(20)11-5-3-4-6-12(11)16(19)21/h3-8H,1-2H3 |
| InChIKey | KKGIFPJATQFRMR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|