C9H9FO3 — CID 55265589
methyl 3-fluoro-5-hydroxy-4-methylbenzoate (PubChem CID 55265589) has the molecular formula C9H9FO3 and a molecular weight of 184.17 g/mol. Its IUPAC name is methyl 3-fluoro-5-hydroxy-4-methylbenzoate.
| Compound Name | methyl 3-fluoro-5-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 55265589 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | methyl 3-fluoro-5-hydroxy-4-methylbenzoate |
| SMILES | COC(=O)c1cc(O)c(C)c(F)c1 |
| InChI | InChI=1S/C9H9FO3/c1-5-7(10)3-6(4-8(5)11)9(12)13-2/h3-4,11H,1-2H3 |
| InChIKey | XGUDTZGRCCTTMQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |