About 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate
3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate (PubChem CID 143369201) has the molecular formula C17H14F2I2O4
and a molecular weight of 574.10 g/mol. Its IUPAC name is 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate.
Molecular Properties
| Compound Name | 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate |
| PubChem CID | 143369201 |
| Molecular Formula | C17H14F2I2O4 |
| Molecular Weight | 574.10 g/mol |
| Exact Mass | 573.89 |
| IUPAC Name | 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate |
| SMILES | COC(=O)c1cc(F)c(C)c(I)c1.Cc1c(F)cc(C(=O)O)cc1I |
| InChI | InChI=1S/C9H8FIO2.C8H6FIO2/c1-5-7(10)3-6(4-8(5)11)9(12)13-2;1-4-6(9)2-5(8(11)12)3-7(4)10/h3-4H,1-2H3;2-3H,1H3,(H,11,12) |
| InChIKey | AXYZAEHQUXPYLO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 574.10 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate?
The IUPAC name of 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate (CID 143369201) is 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate.
What is the SMILES notation for 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate?
The canonical SMILES for 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate is COC(=O)c1cc(F)c(C)c(I)c1.Cc1c(F)cc(C(=O)O)cc1I.
What is the InChIKey of 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate?
The InChIKey is AXYZAEHQUXPYLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FIO2.C8H6FIO2/c1-5-7(10)3-6(4-8(5)11)9(12)13-2;1-4-6(9)2-5(8(11)12)3-7(4)10/h3-4H,1-2H3;2-3H,1H3,(H,11,12).
What are the key properties of 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate?
3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate has a molecular weight of 574.10 g/mol, XLogP of 4.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-iodo-4-methylbenzoic acid;methyl 3-fluoro-5-iodo-4-methylbenzoate is sourced from PubChem (CID 143369201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).