C31H46O4 — CID 161481507
3,5-ditert-butylbenzoic acid;methyl 3,5-ditert-butylbenzoate (PubChem CID 161481507) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is 3,5-ditert-butylbenzoic acid;methyl 3,5-ditert-butylbenzoate.
| Compound Name | 3,5-ditert-butylbenzoic acid;methyl 3,5-ditert-butylbenzoate |
|---|---|
| PubChem CID | 161481507 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 3,5-ditert-butylbenzoic acid;methyl 3,5-ditert-butylbenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)O)cc(C(C)(C)C)c1.COC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H24O2.C15H22O2/c1-15(2,3)12-8-11(14(17)18-7)9-13(10-12)16(4,5)6;1-14(2,3)11-7-10(13(16)17)8-12(9-11)15(4,5)6/h8-10H,1-7H3;7-9H,1-6H3,(H,16,17) |
| InChIKey | WEKNHYAUBHPIHX-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |