C27H32N2O6 — CID 158537958
3-tert-butyl-5-cyano-4-methoxybenzoic acid;methyl 3-tert-butyl-5-cyano-4-methoxybenzoate (PubChem CID 158537958) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is 3-tert-butyl-5-cyano-4-methoxybenzoic acid;methyl 3-tert-butyl-5-cyano-4-methoxybenzoate.
| Compound Name | 3-tert-butyl-5-cyano-4-methoxybenzoic acid;methyl 3-tert-butyl-5-cyano-4-methoxybenzoate |
|---|---|
| PubChem CID | 158537958 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 3-tert-butyl-5-cyano-4-methoxybenzoic acid;methyl 3-tert-butyl-5-cyano-4-methoxybenzoate |
| SMILES | COC(=O)c1cc(C#N)c(OC)c(C(C)(C)C)c1.COc1c(C#N)cc(C(=O)O)cc1C(C)(C)C |
| InChI | InChI=1S/C14H17NO3.C13H15NO3/c1-14(2,3)11-7-9(13(16)18-5)6-10(8-15)12(11)17-4;1-13(2,3)10-6-8(12(15)16)5-9(7-14)11(10)17-4/h6-7H,1-5H3;5-6H,1-4H3,(H,15,16) |
| InChIKey | HOEBRDWIQXITGL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |