About CID 153289995
CID 153289995 (PubChem CID 153289995) has the molecular formula C8H5BiF2O2
and a molecular weight of 380.10 g/mol.
Molecular Properties
| Compound Name | CID 153289995 |
| PubChem CID | 153289995 |
| Molecular Formula | C8H5BiF2O2 |
| Molecular Weight | 380.10 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | — |
| SMILES | Cc1c(F)cc(C(=O)O[Bi])cc1F |
| InChI | InChI=1S/C8H6F2O2.Bi/c1-4-6(9)2-5(8(11)12)3-7(4)10;/h2-3H,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | SFTSJOAVCANBQI-UHFFFAOYSA-M |
| XLogP | 1.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.10 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 153289995 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153289995?
The IUPAC name of CID 153289995 (CID 153289995) is not available.
What is the SMILES notation for CID 153289995?
The canonical SMILES for CID 153289995 is Cc1c(F)cc(C(=O)O[Bi])cc1F.
What is the InChIKey of CID 153289995?
The InChIKey is SFTSJOAVCANBQI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6F2O2.Bi/c1-4-6(9)2-5(8(11)12)3-7(4)10;/h2-3H,1H3,(H,11,12);/q;+1/p-1.
What are the key properties of CID 153289995?
CID 153289995 has a molecular weight of 380.10 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153289995 is sourced from PubChem (CID 153289995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).