C15H25FO3 — CID 144796029
2,2-dimethylpropane;ethane;methyl 3-fluoro-4-hydroxybenzoate (PubChem CID 144796029) has the molecular formula C15H25FO3 and a molecular weight of 272.36 g/mol. Its IUPAC name is 2,2-dimethylpropane;ethane;methyl 3-fluoro-4-hydroxybenzoate.
| Compound Name | 2,2-dimethylpropane;ethane;methyl 3-fluoro-4-hydroxybenzoate |
|---|---|
| PubChem CID | 144796029 |
| Molecular Formula | C15H25FO3 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2,2-dimethylpropane;ethane;methyl 3-fluoro-4-hydroxybenzoate |
| SMILES | CC.CC(C)(C)C.COC(=O)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C8H7FO3.C5H12.C2H6/c1-12-8(11)5-2-3-7(10)6(9)4-5;1-5(2,3)4;1-2/h2-4,10H,1H3;1-4H3;1-2H3 |
| InChIKey | LCWRWQPJSJQBBH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |