C17H12INO5 — CID 168516193
methyl 4-(1,3-dioxoisoindol-2-yl)-5-iodo-2-methoxybenzoate (PubChem CID 168516193) has the molecular formula C17H12INO5 and a molecular weight of 437.19 g/mol. Its IUPAC name is methyl 4-(1,3-dioxoisoindol-2-yl)-5-iodo-2-methoxybenzoate.
| Compound Name | methyl 4-(1,3-dioxoisoindol-2-yl)-5-iodo-2-methoxybenzoate |
|---|---|
| PubChem CID | 168516193 |
| Molecular Formula | C17H12INO5 |
| Molecular Weight | 437.19 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | methyl 4-(1,3-dioxoisoindol-2-yl)-5-iodo-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(I)c(N2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C17H12INO5/c1-23-14-8-13(12(18)7-11(14)17(22)24-2)19-15(20)9-5-3-4-6-10(9)16(19)21/h3-8H,1-2H3 |
| InChIKey | QWZZPKQHYFDXNP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|