C15H10ClNO3S — CID 59310058
2-(2-chloro-4-methoxy-5-sulfanylphenyl)isoindole-1,3-dione (PubChem CID 59310058) has the molecular formula C15H10ClNO3S and a molecular weight of 319.77 g/mol. Its IUPAC name is 2-(2-chloro-4-methoxy-5-sulfanylphenyl)isoindole-1,3-dione.
| Compound Name | 2-(2-chloro-4-methoxy-5-sulfanylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 59310058 |
| Molecular Formula | C15H10ClNO3S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 2-(2-chloro-4-methoxy-5-sulfanylphenyl)isoindole-1,3-dione |
| SMILES | COc1cc(Cl)c(N2C(=O)c3ccccc3C2=O)cc1S |
| InChI | InChI=1S/C15H10ClNO3S/c1-20-12-6-10(16)11(7-13(12)21)17-14(18)8-4-2-3-5-9(8)15(17)19/h2-7,21H,1H3 |
| InChIKey | WOVOHFHBSJIVHQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|