C19H11FN2O5 — CID 146592168
methyl 2-(1,3-dioxoisoindol-2-yl)-7-fluoro-3-hydroxyquinoline-6-carboxylate (PubChem CID 146592168) has the molecular formula C19H11FN2O5 and a molecular weight of 366.30 g/mol. Its IUPAC name is methyl 2-(1,3-dioxoisoindol-2-yl)-7-fluoro-3-hydroxyquinoline-6-carboxylate.
| Compound Name | methyl 2-(1,3-dioxoisoindol-2-yl)-7-fluoro-3-hydroxyquinoline-6-carboxylate |
|---|---|
| PubChem CID | 146592168 |
| Molecular Formula | C19H11FN2O5 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | methyl 2-(1,3-dioxoisoindol-2-yl)-7-fluoro-3-hydroxyquinoline-6-carboxylate |
| SMILES | COC(=O)c1cc2cc(O)c(N3C(=O)c4ccccc4C3=O)nc2cc1F |
| InChI | InChI=1S/C19H11FN2O5/c1-27-19(26)12-6-9-7-15(23)16(21-14(9)8-13(12)20)22-17(24)10-4-2-3-5-11(10)18(22)25/h2-8,23H,1H3 |
| InChIKey | GQZIHMZBUJNJTE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|