C35H29FN6O6 — CID 149356165
methyl 2-(1,3-dioxoisoindol-2-yl)-7-fluoro-3-[1-[1-(propoxymethyl)-5-pyrazol-1-ylindazol-6-yl]ethoxy]quinoline-6-carboxylate (PubChem CID 149356165) has the molecular formula C35H29FN6O6 and a molecular weight of 648.65 g/mol. Its IUPAC name is methyl 2-(1,3-dioxoisoindol-2-yl)-7-fluoro-3-[1-[1-(propoxymethyl)-5-pyrazol-1-ylindazol-6-yl]ethoxy]quinoline-6-carboxylate.
| Compound Name | methyl 2-(1,3-dioxoisoindol-2-yl)-7-fluoro-3-[1-[1-(propoxymethyl)-5-pyrazol-1-ylindazol-6-yl]ethoxy]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 149356165 |
| Molecular Formula | C35H29FN6O6 |
| Molecular Weight | 648.65 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | methyl 2-(1,3-dioxoisoindol-2-yl)-7-fluoro-3-[1-[1-(propoxymethyl)-5-pyrazol-1-ylindazol-6-yl]ethoxy]quinoline-6-carboxylate |
| SMILES | CCCOCn1ncc2cc(-n3cccn3)c(C(C)Oc3cc4cc(C(=O)OC)c(F)cc4nc3N3C(=O)c4ccccc4C3=O)cc21 |
| InChI | InChI=1S/C35H29FN6O6/c1-4-12-47-19-41-29-16-25(30(14-22(29)18-38-41)40-11-7-10-37-40)20(2)48-31-15-21-13-26(35(45)46-3)27(36)17-28(21)39-32(31)42-33(43)23-8-5-6-9-24(23)34(42)44/h5-11,13-18,20H,4,12,19H2,1-3H3 |
| InChIKey | YGZJQFLUXNVSTJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 130.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|