C16H11NO4 — CID 823415
methyl 1,3-dioxo-2-phenylisoindole-5-carboxylate (PubChem CID 823415) has the molecular formula C16H11NO4 and a molecular weight of 281.27 g/mol. Its IUPAC name is methyl 1,3-dioxo-2-phenylisoindole-5-carboxylate.
| Compound Name | methyl 1,3-dioxo-2-phenylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 823415 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | methyl 1,3-dioxo-2-phenylisoindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C16H11NO4/c1-21-16(20)10-7-8-12-13(9-10)15(19)17(14(12)18)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | HCCMKPYOWKZBAL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|