C28H24N2O5 — CID 19177393
cyclohexyl 4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate (PubChem CID 19177393) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is cyclohexyl 4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate.
| Compound Name | cyclohexyl 4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 19177393 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | cyclohexyl 4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate |
| SMILES | O=C(Nc1ccc(C(=O)OC2CCCCC2)cc1)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C28H24N2O5/c31-25(29-20-15-13-18(14-16-20)28(34)35-22-9-2-1-3-10-22)19-7-6-8-21(17-19)30-26(32)23-11-4-5-12-24(23)27(30)33/h4-8,11-17,22H,1-3,9-10H2,(H,29,31) |
| InChIKey | WIKIVIACVOPTCF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|