C32H23N3O6 — CID 1149114
1-N,3-N-bis(4-acetylphenyl)-5-(1,3-dioxoisoindol-2-yl)benzene-1,3-dicarboxamide (PubChem CID 1149114) has the molecular formula C32H23N3O6 and a molecular weight of 545.55 g/mol. Its IUPAC name is 1-N,3-N-bis(4-acetylphenyl)-5-(1,3-dioxoisoindol-2-yl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(4-acetylphenyl)-5-(1,3-dioxoisoindol-2-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 1149114 |
| Molecular Formula | C32H23N3O6 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 1-N,3-N-bis(4-acetylphenyl)-5-(1,3-dioxoisoindol-2-yl)benzene-1,3-dicarboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2cc(C(=O)Nc3ccc(C(C)=O)cc3)cc(N3C(=O)c4ccccc4C3=O)c2)cc1 |
| InChI | InChI=1S/C32H23N3O6/c1-18(36)20-7-11-24(12-8-20)33-29(38)22-15-23(30(39)34-25-13-9-21(10-14-25)19(2)37)17-26(16-22)35-31(40)27-5-3-4-6-28(27)32(35)41/h3-17H,1-2H3,(H,33,38)(H,34,39) |
| InChIKey | UKTLOWVHSKFSHR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|