C38H23N3O6 — CID 3558893
3,5-bis(1,3-dioxoisoindol-2-yl)-N-[4-(3-oxo-3-phenylprop-1-enyl)phenyl]benzamide (PubChem CID 3558893) has the molecular formula C38H23N3O6 and a molecular weight of 617.62 g/mol. Its IUPAC name is 3,5-bis(1,3-dioxoisoindol-2-yl)-N-[4-(3-oxo-3-phenylprop-1-enyl)phenyl]benzamide.
| Compound Name | 3,5-bis(1,3-dioxoisoindol-2-yl)-N-[4-(3-oxo-3-phenylprop-1-enyl)phenyl]benzamide |
|---|---|
| PubChem CID | 3558893 |
| Molecular Formula | C38H23N3O6 |
| Molecular Weight | 617.62 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | 3,5-bis(1,3-dioxoisoindol-2-yl)-N-[4-(3-oxo-3-phenylprop-1-enyl)phenyl]benzamide |
| SMILES | O=C(C=Cc1ccc(NC(=O)c2cc(N3C(=O)c4ccccc4C3=O)cc(N3C(=O)c4ccccc4C3=O)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C38H23N3O6/c42-33(24-8-2-1-3-9-24)19-16-23-14-17-26(18-15-23)39-34(43)25-20-27(40-35(44)29-10-4-5-11-30(29)36(40)45)22-28(21-25)41-37(46)31-12-6-7-13-32(31)38(41)47/h1-22H,(H,39,43) |
| InChIKey | MWMMHADRWZKASJ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|