C47H28N2O7 — CID 46501018
5-[1,3-dioxo-2-[4-[(E)-3-phenylprop-2-enoyl]phenyl]isoindole-5-carbonyl]-2-[4-[(E)-3-phenylprop-2-enoyl]phenyl]isoindole-1,3-dione (PubChem CID 46501018) has the molecular formula C47H28N2O7 and a molecular weight of 732.75 g/mol. Its IUPAC name is 5-[1,3-dioxo-2-[4-[(E)-3-phenylprop-2-enoyl]phenyl]isoindole-5-carbonyl]-2-[4-[(E)-3-phenylprop-2-enoyl]phenyl]isoindole-1,3-dione.
| Compound Name | 5-[1,3-dioxo-2-[4-[(E)-3-phenylprop-2-enoyl]phenyl]isoindole-5-carbonyl]-2-[4-[(E)-3-phenylprop-2-enoyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 46501018 |
| Molecular Formula | C47H28N2O7 |
| Molecular Weight | 732.75 g/mol |
| Exact Mass | 732.19 |
| IUPAC Name | 5-[1,3-dioxo-2-[4-[(E)-3-phenylprop-2-enoyl]phenyl]isoindole-5-carbonyl]-2-[4-[(E)-3-phenylprop-2-enoyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C(/C=C/c1ccccc1)c1ccc(N2C(=O)c3ccc(C(=O)c4ccc5c(c4)C(=O)N(c4ccc(C(=O)/C=C/c6ccccc6)cc4)C5=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C47H28N2O7/c50-41(25-11-29-7-3-1-4-8-29)31-13-19-35(20-14-31)48-44(53)37-23-17-33(27-39(37)46(48)55)43(52)34-18-24-38-40(28-34)47(56)49(45(38)54)36-21-15-32(16-22-36)42(51)26-12-30-9-5-2-6-10-30/h1-28H/b25-11+,26-12+ |
| InChIKey | QZGGNQBRFJTPIY-KOZSXFMUSA-N |
| XLogP | 8.31 |
| TPSA | 125.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.75 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|