C46H31N3O6 — CID 5286630
1,3-dioxo-N-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenyl]-2-[3-[[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenyl]carbamoyl]phenyl]isoindole-5-carboxamide (PubChem CID 5286630) has the molecular formula C46H31N3O6 and a molecular weight of 721.77 g/mol. Its IUPAC name is 1,3-dioxo-N-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenyl]-2-[3-[[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenyl]carbamoyl]phenyl]isoindole-5-carboxamide.
| Compound Name | 1,3-dioxo-N-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenyl]-2-[3-[[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenyl]carbamoyl]phenyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 5286630 |
| Molecular Formula | C46H31N3O6 |
| Molecular Weight | 721.77 g/mol |
| Exact Mass | 721.22 |
| IUPAC Name | 1,3-dioxo-N-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenyl]-2-[3-[[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenyl]carbamoyl]phenyl]isoindole-5-carboxamide |
| SMILES | O=C(/C=C\c1ccc(NC(=O)c2cccc(N3C(=O)c4ccc(C(=O)Nc5ccc(/C=C\C(=O)c6ccccc6)cc5)cc4C3=O)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H31N3O6/c50-41(32-8-3-1-4-9-32)26-18-30-14-21-36(22-15-30)47-43(52)34-12-7-13-38(28-34)49-45(54)39-25-20-35(29-40(39)46(49)55)44(53)48-37-23-16-31(17-24-37)19-27-42(51)33-10-5-2-6-11-33/h1-29H,(H,47,52)(H,48,53)/b26-18-,27-19- |
| InChIKey | VXEVPQYUEAJYRW-WCOOBMQKSA-N |
| XLogP | 8.78 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.77 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|