C32H24N2O5 — CID 162394999
2-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]benzamide (PubChem CID 162394999) has the molecular formula C32H24N2O5 and a molecular weight of 516.55 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]benzamide.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 162394999 |
| Molecular Formula | C32H24N2O5 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]benzamide |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(NC(=O)c3ccccc3CN3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C32H24N2O5/c1-39-25-17-10-21(11-18-25)12-19-29(35)22-13-15-24(16-14-22)33-30(36)26-7-3-2-6-23(26)20-34-31(37)27-8-4-5-9-28(27)32(34)38/h2-19H,20H2,1H3,(H,33,36)/b19-12+ |
| InChIKey | JBOHYFQAAQZCNT-XDHOZWIPSA-N |
| XLogP | 5.64 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|