C25H23NO3S — CID 2926145
2-(4-methoxyphenyl)-N-[4-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]acetamide (PubChem CID 2926145) has the molecular formula C25H23NO3S and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[4-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[4-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2926145 |
| Molecular Formula | C25H23NO3S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[4-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(C(=O)C=Cc3ccc(SC)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H23NO3S/c1-29-22-12-3-19(4-13-22)17-25(28)26-21-10-8-20(9-11-21)24(27)16-7-18-5-14-23(30-2)15-6-18/h3-16H,17H2,1-2H3,(H,26,28) |
| InChIKey | FHDVMVOJBJYZSG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|