C22H25NO2S — CID 5102322
2-ethyl-N-[4-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]butanamide (PubChem CID 5102322) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is 2-ethyl-N-[4-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]butanamide.
| Compound Name | 2-ethyl-N-[4-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 5102322 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-ethyl-N-[4-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]butanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(C(=O)C=Cc2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C22H25NO2S/c1-4-17(5-2)22(25)23-19-11-9-18(10-12-19)21(24)15-8-16-6-13-20(26-3)14-7-16/h6-15,17H,4-5H2,1-3H3,(H,23,25) |
| InChIKey | DFGWDGKUZKPEFA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|