C20H20O3S2 — CID 10317192
2-methyl-2-[4-[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]sulfanylpropanoic acid (PubChem CID 10317192) has the molecular formula C20H20O3S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-methyl-2-[4-[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-methyl-2-[4-[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 10317192 |
| Molecular Formula | C20H20O3S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-methyl-2-[4-[(E)-3-(4-methylsulfanylphenyl)prop-2-enoyl]phenyl]sulfanylpropanoic acid |
| SMILES | CSc1ccc(/C=C/C(=O)c2ccc(SC(C)(C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H20O3S2/c1-20(2,19(22)23)25-17-11-7-15(8-12-17)18(21)13-6-14-4-9-16(24-3)10-5-14/h4-13H,1-3H3,(H,22,23)/b13-6+ |
| InChIKey | KCQQFSJYSFUKFS-AWNIVKPZSA-N |
| XLogP | 5.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|