C17H16OS2 — CID 5378556
(E)-1,3-bis(4-methylsulfanylphenyl)prop-2-en-1-one (PubChem CID 5378556) has the molecular formula C17H16OS2 and a molecular weight of 300.45 g/mol. Its IUPAC name is (E)-1,3-bis(4-methylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1,3-bis(4-methylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5378556 |
| Molecular Formula | C17H16OS2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (E)-1,3-bis(4-methylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CSc1ccc(/C=C/C(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C17H16OS2/c1-19-15-8-3-13(4-9-15)5-12-17(18)14-6-10-16(20-2)11-7-14/h3-12H,1-2H3/b12-5+ |
| InChIKey | RSFMOXYGJZKDCF-LFYBBSHMSA-N |
| XLogP | 5.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|