C21H17NO3S — CID 3119793
N-[4-[3-(4-methoxyphenyl)prop-2-enoyl]phenyl]thiophene-2-carboxamide (PubChem CID 3119793) has the molecular formula C21H17NO3S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[4-[3-(4-methoxyphenyl)prop-2-enoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[3-(4-methoxyphenyl)prop-2-enoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3119793 |
| Molecular Formula | C21H17NO3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[4-[3-(4-methoxyphenyl)prop-2-enoyl]phenyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(C=CC(=O)c2ccc(NC(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C21H17NO3S/c1-25-18-11-4-15(5-12-18)6-13-19(23)16-7-9-17(10-8-16)22-21(24)20-3-2-14-26-20/h2-14H,1H3,(H,22,24) |
| InChIKey | AFHZOPUMLSITHH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|