C19H15NO4S — CID 1092077
[4-[(4-methoxyphenyl)carbamoyl]phenyl] thiophene-2-carboxylate (PubChem CID 1092077) has the molecular formula C19H15NO4S and a molecular weight of 353.40 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)carbamoyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(4-methoxyphenyl)carbamoyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1092077 |
| Molecular Formula | C19H15NO4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | [4-[(4-methoxyphenyl)carbamoyl]phenyl] thiophene-2-carboxylate |
| SMILES | COc1ccc(NC(=O)c2ccc(OC(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C19H15NO4S/c1-23-15-10-6-14(7-11-15)20-18(21)13-4-8-16(9-5-13)24-19(22)17-3-2-12-25-17/h2-12H,1H3,(H,20,21) |
| InChIKey | TZZIAKJSAPYLKV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|